About (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one
(5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one (PubChem CID 58431780) has the molecular formula C18H17F2N3O3
and a molecular weight of 361.35 g/mol. Its IUPAC name is (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one.
Molecular Properties
| Compound Name | (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one |
| PubChem CID | 58431780 |
| Molecular Formula | C18H17F2N3O3 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one |
| SMILES | O=C1CC[C@H]([N+](=O)[O-])C(c2cc(F)ccc2F)N1CCc1ccccn1 |
| InChI | InChI=1S/C18H17F2N3O3/c19-12-4-5-15(20)14(11-12)18-16(23(25)26)6-7-17(24)22(18)10-8-13-3-1-2-9-21-13/h1-5,9,11,16,18H,6-8,10H2/t16-,18?/m0/s1 |
| InChIKey | JXDBXWKWLWCQRL-ATNAJCNCSA-N |
| XLogP | 2.91 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one?
The IUPAC name of (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one (CID 58431780) is (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one.
What is the SMILES notation for (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one?
The canonical SMILES for (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one is O=C1CC[C@H]([N+](=O)[O-])C(c2cc(F)ccc2F)N1CCc1ccccn1.
What is the InChIKey of (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one?
The InChIKey is JXDBXWKWLWCQRL-ATNAJCNCSA-N. The full InChI is InChI=1S/C18H17F2N3O3/c19-12-4-5-15(20)14(11-12)18-16(23(25)26)6-7-17(24)22(18)10-8-13-3-1-2-9-21-13/h1-5,9,11,16,18H,6-8,10H2/t16-,18?/m0/s1.
What are the key properties of (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one?
(5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one has a molecular weight of 361.35 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-6-(2,5-difluorophenyl)-5-nitro-1-(2-pyridin-2-ylethyl)piperidin-2-one is sourced from PubChem (CID 58431780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).