C20H22F2N6 — CID 58431791
(3S,5R)-2-(2,5-difluorophenyl)-1-methyl-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)piperidin-3-amine (PubChem CID 58431791) has the molecular formula C20H22F2N6 and a molecular weight of 384.43 g/mol. Its IUPAC name is (3S,5R)-2-(2,5-difluorophenyl)-1-methyl-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)piperidin-3-amine.
| Compound Name | (3S,5R)-2-(2,5-difluorophenyl)-1-methyl-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 58431791 |
| Molecular Formula | C20H22F2N6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (3S,5R)-2-(2,5-difluorophenyl)-1-methyl-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)piperidin-3-amine |
| SMILES | CN1C[C@H](N2Cc3nn4cccnc4c3C2)C[C@H](N)C1c1cc(F)ccc1F |
| InChI | InChI=1S/C20H22F2N6/c1-26-9-13(8-17(23)19(26)14-7-12(21)3-4-16(14)22)27-10-15-18(11-27)25-28-6-2-5-24-20(15)28/h2-7,13,17,19H,8-11,23H2,1H3/t13-,17+,19?/m1/s1 |
| InChIKey | IOFWGHWSGRTGKO-XHNGYCAMSA-N |
| XLogP | 2.10 |
| TPSA | 62.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |