About N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide
N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide (PubChem CID 58432279) has the molecular formula C19H13ClF2N4O
and a molecular weight of 386.79 g/mol. Its IUPAC name is N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide |
| PubChem CID | 58432279 |
| Molecular Formula | C19H13ClF2N4O |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide |
| SMILES | Cc1cc2c(cc1Cl)N=C(c1[nH]ncc1NC(=O)c1c(F)cccc1F)C2 |
| InChI | InChI=1S/C19H13ClF2N4O/c1-9-5-10-6-15(24-14(10)7-11(9)20)18-16(8-23-26-18)25-19(27)17-12(21)3-2-4-13(17)22/h2-5,7-8H,6H2,1H3,(H,23,26)(H,25,27) |
| InChIKey | VREZRQXJRFHEBR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide?
The IUPAC name of N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide (CID 58432279) is N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide?
The canonical SMILES for N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide is Cc1cc2c(cc1Cl)N=C(c1[nH]ncc1NC(=O)c1c(F)cccc1F)C2.
What is the InChIKey of N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide?
The InChIKey is VREZRQXJRFHEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClF2N4O/c1-9-5-10-6-15(24-14(10)7-11(9)20)18-16(8-23-26-18)25-19(27)17-12(21)3-2-4-13(17)22/h2-5,7-8H,6H2,1H3,(H,23,26)(H,25,27).
What are the key properties of N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide?
N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide has a molecular weight of 386.79 g/mol, XLogP of 4.58, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(6-chloro-5-methyl-3H-indol-2-yl)-1H-pyrazol-4-yl]-2,6-difluorobenzamide is sourced from PubChem (CID 58432279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).