About benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate
benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate (PubChem CID 58432815) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate.
Molecular Properties
| Compound Name | benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate |
| PubChem CID | 58432815 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate |
| SMILES | C[C@H]1C[C@@]2(C=CC(=O)N2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H20N2O3/c1-13-11-17(8-7-15(20)18-17)9-10-19(13)16(21)22-12-14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3,(H,18,20)/t13-,17+/m0/s1 |
| InChIKey | UJWAJHXBZISLFR-SUMWQHHRSA-N |
| XLogP | 2.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate?
The IUPAC name of benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate (CID 58432815) is benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate.
What is the SMILES notation for benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate?
The canonical SMILES for benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate is C[C@H]1C[C@@]2(C=CC(=O)N2)CCN1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate?
The InChIKey is UJWAJHXBZISLFR-SUMWQHHRSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-13-11-17(8-7-15(20)18-17)9-10-19(13)16(21)22-12-14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3,(H,18,20)/t13-,17+/m0/s1.
What are the key properties of benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate?
benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate has a molecular weight of 300.36 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (5R,7S)-7-methyl-2-oxo-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate is sourced from PubChem (CID 58432815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).