C16H24O2 — CID 58432874
1-tert-butyl-3-(3,3-dimethoxycyclobutyl)benzene (PubChem CID 58432874) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,3-dimethoxycyclobutyl)benzene.
| Compound Name | 1-tert-butyl-3-(3,3-dimethoxycyclobutyl)benzene |
|---|---|
| PubChem CID | 58432874 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-tert-butyl-3-(3,3-dimethoxycyclobutyl)benzene |
| SMILES | COC1(OC)CC(c2cccc(C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C16H24O2/c1-15(2,3)14-8-6-7-12(9-14)13-10-16(11-13,17-4)18-5/h6-9,13H,10-11H2,1-5H3 |
| InChIKey | ZVPBQPWFCYZQBJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|