C17H21NO — CID 58433015
(1R,10S)-16-methyl-14-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,16-trien-5-one (PubChem CID 58433015) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (1R,10S)-16-methyl-14-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,16-trien-5-one.
| Compound Name | (1R,10S)-16-methyl-14-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,16-trien-5-one |
|---|---|
| PubChem CID | 58433015 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (1R,10S)-16-methyl-14-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,16-trien-5-one |
| SMILES | CC1=CC2CC3=C(C=CC(=O)C3)[C@]3(C1)NCCC[C@@H]23 |
| InChI | InChI=1S/C17H21NO/c1-11-7-12-8-13-9-14(19)4-5-16(13)17(10-11)15(12)3-2-6-18-17/h4-5,7,12,15,18H,2-3,6,8-10H2,1H3/t12?,15-,17+/m0/s1 |
| InChIKey | ACZKPUGTOQJNQC-BRCNOLGNSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|