C38H65F3O6Si3 — CID 58434138
bis[[dimethyl-[[4-(2,3,3-trimethylbutoxymethyl)phenyl]methoxy]silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane (PubChem CID 58434138) has the molecular formula C38H65F3O6Si3 and a molecular weight of 759.18 g/mol. Its IUPAC name is bis[[dimethyl-[[4-(2,3,3-trimethylbutoxymethyl)phenyl]methoxy]silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane.
| Compound Name | bis[[dimethyl-[[4-(2,3,3-trimethylbutoxymethyl)phenyl]methoxy]silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 58434138 |
| Molecular Formula | C38H65F3O6Si3 |
| Molecular Weight | 759.18 g/mol |
| Exact Mass | 758.40 |
| IUPAC Name | bis[[dimethyl-[[4-(2,3,3-trimethylbutoxymethyl)phenyl]methoxy]silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane |
| SMILES | CC(COCc1ccc(CO[Si](C)(C)O[Si](C)(CCC(F)(F)F)O[Si](C)(C)OCc2ccc(COCC(C)C(C)(C)C)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C38H65F3O6Si3/c1-30(36(3,4)5)24-42-26-32-14-18-34(19-15-32)28-44-48(9,10)46-50(13,23-22-38(39,40)41)47-49(11,12)45-29-35-20-16-33(17-21-35)27-43-25-31(2)37(6,7)8/h14-21,30-31H,22-29H2,1-13H3 |
| InChIKey | WZHHAEHQNDYZLQ-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.18 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|