C19H21NO5 — CID 58434171
2-(4-benzoylphenoxy)-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 58434171) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N,N-bis(2-hydroxyethyl)acetamide.
| Compound Name | 2-(4-benzoylphenoxy)-N,N-bis(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 58434171 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | O=C(c1ccccc1)c1ccc(OCC(=O)N(CCO)CCO)cc1 |
| InChI | InChI=1S/C19H21NO5/c21-12-10-20(11-13-22)18(23)14-25-17-8-6-16(7-9-17)19(24)15-4-2-1-3-5-15/h1-9,21-22H,10-14H2 |
| InChIKey | SHFVFLOPCSIGHX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |