C76H60N8+2 — CID 58435144
21,22,23,24-tetramethyl-2,7,12,17-tetrakis(9-methylcarbazol-3-yl)porphyrin-21,23-diium (PubChem CID 58435144) has the molecular formula C76H60N8+2 and a molecular weight of 1085.37 g/mol. Its IUPAC name is 21,22,23,24-tetramethyl-2,7,12,17-tetrakis(9-methylcarbazol-3-yl)porphyrin-21,23-diium.
| Compound Name | 21,22,23,24-tetramethyl-2,7,12,17-tetrakis(9-methylcarbazol-3-yl)porphyrin-21,23-diium |
|---|---|
| PubChem CID | 58435144 |
| Molecular Formula | C76H60N8+2 |
| Molecular Weight | 1085.37 g/mol |
| Exact Mass | 1084.49 |
| IUPAC Name | 21,22,23,24-tetramethyl-2,7,12,17-tetrakis(9-methylcarbazol-3-yl)porphyrin-21,23-diium |
| SMILES | Cn1c2cc(-c3ccc4c(c3)c3ccccc3n4C)c1cc1[n+](C)c(cc3cc(-c4ccc5c(c4)c4ccccc4n5C)c(cc4[n+](C)c(c2)C(c2ccc5c(c2)c2ccccc2n5C)=C4)n3C)C(c2ccc3c(c2)c2ccccc2n3C)=C1 |
| InChI | InChI=1S/C76H60N8/c1-77-49-37-57(45-25-29-69-61(33-45)53-17-9-13-21-65(53)81(69)5)73(77)42-50-38-59(47-27-31-71-63(35-47)55-19-11-15-23-67(55)83(71)7)75(78(50)2)44-52-40-60(48-28-32-72-64(36-48)56-20-12-16-24-68(56)84(72)8)76(80(52)4)43-51-39-58(74(41-49)79(51)3)46-26-30-70-62(34-46)54-18-10-14-22-66(54)82(70)6/h9-44H,1-8H3/q+2/b49-41-,50-42-,51-43-,52-44-,73-42-,74-41-,75-44-,76-43- |
| InChIKey | AMGXDMMHWXLUPS-ZWBBMJNMSA-N |
| XLogP | 16.29 |
| TPSA | 37.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1085.37 |
| LogP ≤ 5 | 16.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|