About [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate
[3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate (PubChem CID 58435425) has the molecular formula C18H32O8Si
and a molecular weight of 404.53 g/mol. Its IUPAC name is [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate |
| PubChem CID | 58435425 |
| Molecular Formula | C18H32O8Si |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OCC[Si](C)(C)C)C(OC(C)=O)C(C)C1OC(C)=O |
| InChI | InChI=1S/C18H32O8Si/c1-11-16(24-13(3)20)15(10-23-12(2)19)26-18(17(11)25-14(4)21)22-8-9-27(5,6)7/h11,15-18H,8-10H2,1-7H3 |
| InChIKey | HAKXPYSYVBXEKS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate?
The IUPAC name of [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate (CID 58435425) is [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate.
What is the SMILES notation for [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate?
The canonical SMILES for [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate is CC(=O)OCC1OC(OCC[Si](C)(C)C)C(OC(C)=O)C(C)C1OC(C)=O.
What is the InChIKey of [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate?
The InChIKey is HAKXPYSYVBXEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O8Si/c1-11-16(24-13(3)20)15(10-23-12(2)19)26-18(17(11)25-14(4)21)22-8-9-27(5,6)7/h11,15-18H,8-10H2,1-7H3.
What are the key properties of [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate?
[3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate has a molecular weight of 404.53 g/mol, XLogP of 2.13, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-diacetyloxy-4-methyl-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate is sourced from PubChem (CID 58435425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).