About 2-methyl-4,5,6,7-tetrahydroisoindole
2-methyl-4,5,6,7-tetrahydroisoindole (PubChem CID 58435762) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydroisoindole.
Molecular Properties
| Compound Name | 2-methyl-4,5,6,7-tetrahydroisoindole |
| PubChem CID | 58435762 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2-methyl-4,5,6,7-tetrahydroisoindole |
| SMILES | Cn1cc2c(c1)CCCC2 |
| InChI | InChI=1S/C9H13N/c1-10-6-8-4-2-3-5-9(8)7-10/h6-7H,2-5H2,1H3 |
| InChIKey | OVWNDBSVAOBWFL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-4,5,6,7-tetrahydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,7-tetrahydroisoindole?
The IUPAC name of 2-methyl-4,5,6,7-tetrahydroisoindole (CID 58435762) is 2-methyl-4,5,6,7-tetrahydroisoindole.
What is the SMILES notation for 2-methyl-4,5,6,7-tetrahydroisoindole?
The canonical SMILES for 2-methyl-4,5,6,7-tetrahydroisoindole is Cn1cc2c(c1)CCCC2.
What is the InChIKey of 2-methyl-4,5,6,7-tetrahydroisoindole?
The InChIKey is OVWNDBSVAOBWFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-10-6-8-4-2-3-5-9(8)7-10/h6-7H,2-5H2,1H3.
What are the key properties of 2-methyl-4,5,6,7-tetrahydroisoindole?
2-methyl-4,5,6,7-tetrahydroisoindole has a molecular weight of 135.21 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,7-tetrahydroisoindole is sourced from PubChem (CID 58435762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).