C18H14F6O5S — CID 58435904
5-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxyphenyl]-2-methoxybenzenesulfonic acid (PubChem CID 58435904) has the molecular formula C18H14F6O5S and a molecular weight of 456.36 g/mol. Its IUPAC name is 5-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxyphenyl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxyphenyl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 58435904 |
| Molecular Formula | C18H14F6O5S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 5-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxyphenyl]-2-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(-c2ccc(OC3(F)C(C)(F)C(F)(F)C3(F)F)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C18H14F6O5S/c1-15(19)16(20,21)17(22,23)18(15,24)29-12-6-3-10(4-7-12)11-5-8-13(28-2)14(9-11)30(25,26)27/h3-9H,1-2H3,(H,25,26,27) |
| InChIKey | ALMCLVOTOGLXMD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|