C21H14F12O5S — CID 58435905
5-[1,1,1,3,3,3-hexafluoro-2-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxyphenyl]propan-2-yl]-2-methoxybenzenesulfonic acid (PubChem CID 58435905) has the molecular formula C21H14F12O5S and a molecular weight of 606.38 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxyphenyl]propan-2-yl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxyphenyl]propan-2-yl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 58435905 |
| Molecular Formula | C21H14F12O5S |
| Molecular Weight | 606.38 g/mol |
| Exact Mass | 606.04 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxyphenyl]propan-2-yl]-2-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(C(c2ccc(OC3(F)C(C)(F)C(F)(F)C3(F)F)cc2)(C(F)(F)F)C(F)(F)F)cc1S(=O)(=O)O |
| InChI | InChI=1S/C21H14F12O5S/c1-15(22)17(23,24)18(25,26)19(15,27)38-12-6-3-10(4-7-12)16(20(28,29)30,21(31,32)33)11-5-8-13(37-2)14(9-11)39(34,35)36/h3-9H,1-2H3,(H,34,35,36) |
| InChIKey | PTNUCIFNPCUYMI-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.38 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|