C10H17F2NO2S — CID 58435925
1-(difluoromethylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 58435925) has the molecular formula C10H17F2NO2S and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(difluoromethylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 58435925 |
| Molecular Formula | C10H17F2NO2S |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | O=S(=O)(C(F)F)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C10H17F2NO2S/c11-10(12)16(14,15)13-7-3-5-8-4-1-2-6-9(8)13/h8-10H,1-7H2 |
| InChIKey | FGERRURAJJNGCW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |