About N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide
N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide (PubChem CID 58435992) has the molecular formula C17H35F2NO2S
and a molecular weight of 355.54 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide.
Molecular Properties
| Compound Name | N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide |
| PubChem CID | 58435992 |
| Molecular Formula | C17H35F2NO2S |
| Molecular Weight | 355.54 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C17H35F2NO2S/c1-5-9-11-15(7-3)13-20(23(21,22)17(18)19)14-16(8-4)12-10-6-2/h15-17H,5-14H2,1-4H3 |
| InChIKey | YTCVWJOKQIHLAQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide?
The IUPAC name of N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide (CID 58435992) is N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide.
What is the SMILES notation for N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide?
The canonical SMILES for N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide is CCCCC(CC)CN(CC(CC)CCCC)S(=O)(=O)C(F)F.
What is the InChIKey of N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide?
The InChIKey is YTCVWJOKQIHLAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35F2NO2S/c1-5-9-11-15(7-3)13-20(23(21,22)17(18)19)14-16(8-4)12-10-6-2/h15-17H,5-14H2,1-4H3.
What are the key properties of N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide?
N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide has a molecular weight of 355.54 g/mol, XLogP of 5.27, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-ethylhexyl)-1,1-difluoromethanesulfonamide is sourced from PubChem (CID 58435992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).