C12H16F8O4S — CID 58435999
2-(4-cyclohexyl-1,1,2,2-tetrafluorobutoxy)-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 58435999) has the molecular formula C12H16F8O4S and a molecular weight of 408.31 g/mol. Its IUPAC name is 2-(4-cyclohexyl-1,1,2,2-tetrafluorobutoxy)-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-(4-cyclohexyl-1,1,2,2-tetrafluorobutoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 58435999 |
| Molecular Formula | C12H16F8O4S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-(4-cyclohexyl-1,1,2,2-tetrafluorobutoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)CCC1CCCCC1 |
| InChI | InChI=1S/C12H16F8O4S/c13-9(14,7-6-8-4-2-1-3-5-8)10(15,16)24-11(17,18)12(19,20)25(21,22)23/h8H,1-7H2,(H,21,22,23) |
| InChIKey | MHNGIXMBLWNKPU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|