C14H16F2O7 — CID 58436007
(10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl) 2,2-difluoroacetate (PubChem CID 58436007) has the molecular formula C14H16F2O7 and a molecular weight of 334.27 g/mol. Its IUPAC name is (10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl) 2,2-difluoroacetate.
| Compound Name | (10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl) 2,2-difluoroacetate |
|---|---|
| PubChem CID | 58436007 |
| Molecular Formula | C14H16F2O7 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl) 2,2-difluoroacetate |
| SMILES | O=C(OC1C(=O)OC2C3OC4(CCCCC4)OC3OC12)C(F)F |
| InChI | InChI=1S/C14H16F2O7/c15-10(16)12(18)20-8-6-7(19-11(8)17)9-13(21-6)23-14(22-9)4-2-1-3-5-14/h6-10,13H,1-5H2 |
| InChIKey | OWTCXOQZLBLNBN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |