C13H20F4O — CID 58436012
2-[(2-methylpropan-2-yl)oxy]-5-(1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptane (PubChem CID 58436012) has the molecular formula C13H20F4O and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]-5-(1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptane.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]-5-(1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 58436012 |
| Molecular Formula | C13H20F4O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]-5-(1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)OC1CC2CC1CC2C(F)(F)C(F)F |
| InChI | InChI=1S/C13H20F4O/c1-12(2,3)18-10-6-7-4-8(10)5-9(7)13(16,17)11(14)15/h7-11H,4-6H2,1-3H3 |
| InChIKey | WHKWHCUVMCZHSV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|