C11H14F8O — CID 58436054
[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoropropoxy)ethyl]cyclohexane (PubChem CID 58436054) has the molecular formula C11H14F8O and a molecular weight of 314.22 g/mol. Its IUPAC name is [1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoropropoxy)ethyl]cyclohexane.
| Compound Name | [1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoropropoxy)ethyl]cyclohexane |
|---|---|
| PubChem CID | 58436054 |
| Molecular Formula | C11H14F8O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoropropoxy)ethyl]cyclohexane |
| SMILES | CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C11H14F8O/c1-8(12,13)10(16,17)20-11(18,19)9(14,15)7-5-3-2-4-6-7/h7H,2-6H2,1H3 |
| InChIKey | LECGQZGFJBMKTE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|