C10H12F8O4S — CID 58436059
2-(2-cyclohexyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 58436059) has the molecular formula C10H12F8O4S and a molecular weight of 380.25 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-(2-cyclohexyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 58436059 |
| Molecular Formula | C10H12F8O4S |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 2-(2-cyclohexyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C10H12F8O4S/c11-7(12,6-4-2-1-3-5-6)8(13,14)22-9(15,16)10(17,18)23(19,20)21/h6H,1-5H2,(H,19,20,21) |
| InChIKey | NSHCAEKQVYCAOL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|