About [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane
[(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane (PubChem CID 58436116) has the molecular formula C11H17ISi
and a molecular weight of 304.25 g/mol. Its IUPAC name is [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane |
| PubChem CID | 58436116 |
| Molecular Formula | C11H17ISi |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC/C=C\C/C=C/I |
| InChI | InChI=1S/C11H17ISi/c1-13(2,3)11-9-7-5-4-6-8-10-12/h4-5,8,10H,6-7H2,1-3H3/b5-4-,10-8+ |
| InChIKey | GBJGREUKNUYWOY-BTCMVDHLSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane?
The IUPAC name of [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane (CID 58436116) is [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane.
What is the SMILES notation for [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane?
The canonical SMILES for [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane is C[Si](C)(C)C#CC/C=C\C/C=C/I.
What is the InChIKey of [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane?
The InChIKey is GBJGREUKNUYWOY-BTCMVDHLSA-N. The full InChI is InChI=1S/C11H17ISi/c1-13(2,3)11-9-7-5-4-6-8-10-12/h4-5,8,10H,6-7H2,1-3H3/b5-4-,10-8+.
What are the key properties of [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane?
[(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane has a molecular weight of 304.25 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z,7E)-8-iodoocta-4,7-dien-1-ynyl]-trimethylsilane is sourced from PubChem (CID 58436116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).