C28H39N4O4PS — CID 58436218
(3S,4S)-3-(deuteriooxymethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-1-[4-[(4-methylsulfanylphenyl)diazenyl]phenyl]pentan-1-one (PubChem CID 58436218) has the molecular formula C28H39N4O4PS and a molecular weight of 559.69 g/mol. Its IUPAC name is (3S,4S)-3-(deuteriooxymethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-1-[4-[(4-methylsulfanylphenyl)diazenyl]phenyl]pentan-1-one.
| Compound Name | (3S,4S)-3-(deuteriooxymethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-1-[4-[(4-methylsulfanylphenyl)diazenyl]phenyl]pentan-1-one |
|---|---|
| PubChem CID | 58436218 |
| Molecular Formula | C28H39N4O4PS |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | (3S,4S)-3-(deuteriooxymethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-1-[4-[(4-methylsulfanylphenyl)diazenyl]phenyl]pentan-1-one |
| SMILES | [2H]OC[C@H](CC(=O)c1ccc(/N=N/c2ccc(SC)cc2)cc1)[C@H](C)OP(OCC[N+]#[C-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C28H39N4O4PS/c1-20(2)32(21(3)4)37(35-17-16-29-6)36-22(5)24(19-33)18-28(34)23-8-10-25(11-9-23)30-31-26-12-14-27(38-7)15-13-26/h8-15,20-22,24,33H,16-19H2,1-5,7H3/b31-30+/t22-,24-,37?/m0/s1/i33D |
| InChIKey | BEKSMGZOJAJEEB-RRWRFOCDSA-N |
| XLogP | 7.69 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|