About 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium
2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium (PubChem CID 58436787) has the molecular formula C12H15Cl2N2O3+
and a molecular weight of 306.17 g/mol. Its IUPAC name is 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium.
Molecular Properties
| Compound Name | 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium |
| PubChem CID | 58436787 |
| Molecular Formula | C12H15Cl2N2O3+ |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium |
| SMILES | [NH3+]CCO/N=C(\CCC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O3/c13-9-2-1-8(7-10(9)14)11(3-4-12(17)18)16-19-6-5-15/h1-2,7H,3-6,15H2,(H,17,18)/p+1/b16-11+ |
| InChIKey | TUJKGJWQAQEKOW-LFIBNONCSA-O |
| XLogP | 1.82 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium?
The IUPAC name of 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium (CID 58436787) is 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium.
What is the SMILES notation for 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium?
The canonical SMILES for 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium is [NH3+]CCO/N=C(\CCC(=O)O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium?
The InChIKey is TUJKGJWQAQEKOW-LFIBNONCSA-O. The full InChI is InChI=1S/C12H14Cl2N2O3/c13-9-2-1-8(7-10(9)14)11(3-4-12(17)18)16-19-6-5-15/h1-2,7H,3-6,15H2,(H,17,18)/p+1/b16-11+.
What are the key properties of 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium?
2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium has a molecular weight of 306.17 g/mol, XLogP of 1.82, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium is sourced from PubChem (CID 58436787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).