About ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate
ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate (PubChem CID 58437363) has the molecular formula C20H16F2N2O4
and a molecular weight of 386.35 g/mol. Its IUPAC name is ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate.
Molecular Properties
| Compound Name | ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate |
| PubChem CID | 58437363 |
| Molecular Formula | C20H16F2N2O4 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C#N)c3cc(F)c(F)cc32)cc1OCOC |
| InChI | InChI=1S/C20H16F2N2O4/c1-3-27-20(25)14-5-4-13(6-19(14)28-11-26-2)24-10-12(9-23)15-7-16(21)17(22)8-18(15)24/h4-8,10H,3,11H2,1-2H3 |
| InChIKey | GVWRKNVWGVPAGV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate?
The IUPAC name of ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate (CID 58437363) is ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate.
What is the SMILES notation for ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate?
The canonical SMILES for ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate is CCOC(=O)c1ccc(-n2cc(C#N)c3cc(F)c(F)cc32)cc1OCOC.
What is the InChIKey of ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate?
The InChIKey is GVWRKNVWGVPAGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N2O4/c1-3-27-20(25)14-5-4-13(6-19(14)28-11-26-2)24-10-12(9-23)15-7-16(21)17(22)8-18(15)24/h4-8,10H,3,11H2,1-2H3.
What are the key properties of ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate?
ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate has a molecular weight of 386.35 g/mol, XLogP of 3.94, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3-cyano-5,6-difluoroindol-1-yl)-2-(methoxymethoxy)benzoate is sourced from PubChem (CID 58437363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).