C32H36Cl2N2O5 — CID 58437709
2-[5-chloro-2-(3-morpholin-4-ylpropoxy)phenyl]-1-(4-chlorophenyl)-6,7-diethoxy-1,4-dihydroisoquinolin-3-one (PubChem CID 58437709) has the molecular formula C32H36Cl2N2O5 and a molecular weight of 599.56 g/mol. Its IUPAC name is 2-[5-chloro-2-(3-morpholin-4-ylpropoxy)phenyl]-1-(4-chlorophenyl)-6,7-diethoxy-1,4-dihydroisoquinolin-3-one.
| Compound Name | 2-[5-chloro-2-(3-morpholin-4-ylpropoxy)phenyl]-1-(4-chlorophenyl)-6,7-diethoxy-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 58437709 |
| Molecular Formula | C32H36Cl2N2O5 |
| Molecular Weight | 599.56 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 2-[5-chloro-2-(3-morpholin-4-ylpropoxy)phenyl]-1-(4-chlorophenyl)-6,7-diethoxy-1,4-dihydroisoquinolin-3-one |
| SMILES | CCOc1cc2c(cc1OCC)C(c1ccc(Cl)cc1)N(c1cc(Cl)ccc1OCCCN1CCOCC1)C(=O)C2 |
| InChI | InChI=1S/C32H36Cl2N2O5/c1-3-39-29-18-23-19-31(37)36(32(22-6-8-24(33)9-7-22)26(23)21-30(29)40-4-2)27-20-25(34)10-11-28(27)41-15-5-12-35-13-16-38-17-14-35/h6-11,18,20-21,32H,3-5,12-17,19H2,1-2H3 |
| InChIKey | NFHXBIXVQYVNLG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|