C33H39ClN2O5 — CID 58437764
1-(4-chlorophenyl)-6,7-diethoxy-2-[4-methyl-2-(3-morpholin-4-ylpropoxy)phenyl]-1,4-dihydroisoquinolin-3-one (PubChem CID 58437764) has the molecular formula C33H39ClN2O5 and a molecular weight of 579.14 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6,7-diethoxy-2-[4-methyl-2-(3-morpholin-4-ylpropoxy)phenyl]-1,4-dihydroisoquinolin-3-one.
| Compound Name | 1-(4-chlorophenyl)-6,7-diethoxy-2-[4-methyl-2-(3-morpholin-4-ylpropoxy)phenyl]-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 58437764 |
| Molecular Formula | C33H39ClN2O5 |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 1-(4-chlorophenyl)-6,7-diethoxy-2-[4-methyl-2-(3-morpholin-4-ylpropoxy)phenyl]-1,4-dihydroisoquinolin-3-one |
| SMILES | CCOc1cc2c(cc1OCC)C(c1ccc(Cl)cc1)N(c1ccc(C)cc1OCCCN1CCOCC1)C(=O)C2 |
| InChI | InChI=1S/C33H39ClN2O5/c1-4-39-30-20-25-21-32(37)36(33(24-8-10-26(34)11-9-24)27(25)22-31(30)40-5-2)28-12-7-23(3)19-29(28)41-16-6-13-35-14-17-38-18-15-35/h7-12,19-20,22,33H,4-6,13-18,21H2,1-3H3 |
| InChIKey | KBSIRPIXPFGKMT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|