About 5-(3-methylbutyl)-1,3-benzothiazole
5-(3-methylbutyl)-1,3-benzothiazole (PubChem CID 58439655) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is 5-(3-methylbutyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-(3-methylbutyl)-1,3-benzothiazole |
| PubChem CID | 58439655 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-(3-methylbutyl)-1,3-benzothiazole |
| SMILES | CC(C)CCc1ccc2scnc2c1 |
| InChI | InChI=1S/C12H15NS/c1-9(2)3-4-10-5-6-12-11(7-10)13-8-14-12/h5-9H,3-4H2,1-2H3 |
| InChIKey | ULIIRYCYJYEZIQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3-methylbutyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylbutyl)-1,3-benzothiazole?
The IUPAC name of 5-(3-methylbutyl)-1,3-benzothiazole (CID 58439655) is 5-(3-methylbutyl)-1,3-benzothiazole.
What is the SMILES notation for 5-(3-methylbutyl)-1,3-benzothiazole?
The canonical SMILES for 5-(3-methylbutyl)-1,3-benzothiazole is CC(C)CCc1ccc2scnc2c1.
What is the InChIKey of 5-(3-methylbutyl)-1,3-benzothiazole?
The InChIKey is ULIIRYCYJYEZIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS/c1-9(2)3-4-10-5-6-12-11(7-10)13-8-14-12/h5-9H,3-4H2,1-2H3.
What are the key properties of 5-(3-methylbutyl)-1,3-benzothiazole?
5-(3-methylbutyl)-1,3-benzothiazole has a molecular weight of 205.33 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylbutyl)-1,3-benzothiazole is sourced from PubChem (CID 58439655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).