C25H23F3N6O3 — CID 58439948
4-[(2,3,6-trifluorophenyl)methylamino]-6-[[5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)-2-pyridinyl]methyl]pyridine-3-carboxamide (PubChem CID 58439948) has the molecular formula C25H23F3N6O3 and a molecular weight of 512.49 g/mol. Its IUPAC name is 4-[(2,3,6-trifluorophenyl)methylamino]-6-[[5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)-2-pyridinyl]methyl]pyridine-3-carboxamide.
| Compound Name | 4-[(2,3,6-trifluorophenyl)methylamino]-6-[[5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)-2-pyridinyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58439948 |
| Molecular Formula | C25H23F3N6O3 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 4-[(2,3,6-trifluorophenyl)methylamino]-6-[[5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)-2-pyridinyl]methyl]pyridine-3-carboxamide |
| SMILES | CN1C(=O)N(c2ccc(Cc3cc(NCc4c(F)ccc(F)c4F)c(C(N)=O)cn3)nc2)C(=O)C1(C)C |
| InChI | InChI=1S/C25H23F3N6O3/c1-25(2)23(36)34(24(37)33(25)3)15-5-4-13(30-10-15)8-14-9-20(17(12-31-14)22(29)35)32-11-16-18(26)6-7-19(27)21(16)28/h4-7,9-10,12H,8,11H2,1-3H3,(H2,29,35)(H,31,32) |
| InChIKey | RUENJEOSJVXTAW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|