About tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate
tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 58440006) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate |
| PubChem CID | 58440006 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](N)[C@@H](CO)C1 |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)16-10(15)13-5-4-9(12)8(6-13)7-14/h8-9,14H,4-7,12H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | JJYWLFQRQOTSKA-RKDXNWHRSA-N |
| XLogP | 0.56 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate (CID 58440006) is tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CC[C@@H](N)[C@@H](CO)C1.
What is the InChIKey of tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate?
The InChIKey is JJYWLFQRQOTSKA-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-11(2,3)16-10(15)13-5-4-9(12)8(6-13)7-14/h8-9,14H,4-7,12H2,1-3H3/t8-,9-/m1/s1.
What are the key properties of tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate?
tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate has a molecular weight of 230.31 g/mol, XLogP of 0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S,4R)-4-amino-3-(hydroxymethyl)piperidine-1-carboxylate is sourced from PubChem (CID 58440006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).