About 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide
4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 58440120) has the molecular formula C19H17F2N5O
and a molecular weight of 369.38 g/mol. Its IUPAC name is 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide |
| PubChem CID | 58440120 |
| Molecular Formula | C19H17F2N5O |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | CC(Nc1cc(Cc2cnccn2)ncc1C(N)=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C19H17F2N5O/c1-11(12-4-13(20)6-14(21)5-12)26-18-8-15(25-10-17(18)19(22)27)7-16-9-23-2-3-24-16/h2-6,8-11H,7H2,1H3,(H2,22,27)(H,25,26) |
| InChIKey | FFMGEVPGZSRXRJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide?
The IUPAC name of 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide (CID 58440120) is 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide.
What is the SMILES notation for 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide?
The canonical SMILES for 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide is CC(Nc1cc(Cc2cnccn2)ncc1C(N)=O)c1cc(F)cc(F)c1.
What is the InChIKey of 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide?
The InChIKey is FFMGEVPGZSRXRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N5O/c1-11(12-4-13(20)6-14(21)5-12)26-18-8-15(25-10-17(18)19(22)27)7-16-9-23-2-3-24-16/h2-6,8-11H,7H2,1H3,(H2,22,27)(H,25,26).
What are the key properties of 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide?
4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide has a molecular weight of 369.38 g/mol, XLogP of 3.01, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,5-difluorophenyl)ethylamino]-6-(pyrazin-2-ylmethyl)pyridine-3-carboxamide is sourced from PubChem (CID 58440120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).