C17H16ClFN6O — CID 58440219
6-chloro-4-[[(3S,4R)-1-(5-cyano-2-pyridinyl)-3-fluoropiperidin-4-yl]amino]pyridine-3-carboxamide (PubChem CID 58440219) has the molecular formula C17H16ClFN6O and a molecular weight of 374.81 g/mol. Its IUPAC name is 6-chloro-4-[[(3S,4R)-1-(5-cyano-2-pyridinyl)-3-fluoropiperidin-4-yl]amino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[[(3S,4R)-1-(5-cyano-2-pyridinyl)-3-fluoropiperidin-4-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58440219 |
| Molecular Formula | C17H16ClFN6O |
| Molecular Weight | 374.81 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 6-chloro-4-[[(3S,4R)-1-(5-cyano-2-pyridinyl)-3-fluoropiperidin-4-yl]amino]pyridine-3-carboxamide |
| SMILES | N#Cc1ccc(N2CC[C@@H](Nc3cc(Cl)ncc3C(N)=O)[C@@H](F)C2)nc1 |
| InChI | InChI=1S/C17H16ClFN6O/c18-15-5-14(11(8-22-15)17(21)26)24-13-3-4-25(9-12(13)19)16-2-1-10(6-20)7-23-16/h1-2,5,7-8,12-13H,3-4,9H2,(H2,21,26)(H,22,24)/t12-,13+/m0/s1 |
| InChIKey | GGBUHZKYHWCMHT-QWHCGFSZSA-N |
| XLogP | 2.13 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|