C15H12ClF2N3O — CID 58440270
6-chloro-4-[(4,7-difluoro-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-carboxamide (PubChem CID 58440270) has the molecular formula C15H12ClF2N3O and a molecular weight of 323.73 g/mol. Its IUPAC name is 6-chloro-4-[(4,7-difluoro-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[(4,7-difluoro-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58440270 |
| Molecular Formula | C15H12ClF2N3O |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 6-chloro-4-[(4,7-difluoro-2,3-dihydro-1H-inden-1-yl)amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Cl)cc1NC1CCc2c(F)ccc(F)c21 |
| InChI | InChI=1S/C15H12ClF2N3O/c16-13-5-12(8(6-20-13)15(19)22)21-11-4-1-7-9(17)2-3-10(18)14(7)11/h2-3,5-6,11H,1,4H2,(H2,19,22)(H,20,21) |
| InChIKey | MVHYOUDXTJMDQU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|