About 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine
1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine (PubChem CID 58441203) has the molecular formula C12H14N4O
and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine.
Molecular Properties
| Compound Name | 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine |
| PubChem CID | 58441203 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine |
| SMILES | COc1cccc(N2CCn3nc(N)cc32)c1 |
| InChI | InChI=1S/C12H14N4O/c1-17-10-4-2-3-9(7-10)15-5-6-16-12(15)8-11(13)14-16/h2-4,7-8H,5-6H2,1H3,(H2,13,14) |
| InChIKey | FWHCNPZLIARJAQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine?
The IUPAC name of 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine (CID 58441203) is 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine.
What is the SMILES notation for 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine?
The canonical SMILES for 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine is COc1cccc(N2CCn3nc(N)cc32)c1.
What is the InChIKey of 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine?
The InChIKey is FWHCNPZLIARJAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O/c1-17-10-4-2-3-9(7-10)15-5-6-16-12(15)8-11(13)14-16/h2-4,7-8H,5-6H2,1H3,(H2,13,14).
What are the key properties of 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine?
1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine has a molecular weight of 230.27 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxyphenyl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-amine is sourced from PubChem (CID 58441203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).