C34H43N11O4S — CID 58441262
(E)-7-[2-(2-azidoethoxy)ethyl-methylamino]-1-[4-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazin-1-yl]hept-5-ene-1,4-dione (PubChem CID 58441262) has the molecular formula C34H43N11O4S and a molecular weight of 701.86 g/mol. Its IUPAC name is (E)-7-[2-(2-azidoethoxy)ethyl-methylamino]-1-[4-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazin-1-yl]hept-5-ene-1,4-dione.
| Compound Name | (E)-7-[2-(2-azidoethoxy)ethyl-methylamino]-1-[4-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazin-1-yl]hept-5-ene-1,4-dione |
|---|---|
| PubChem CID | 58441262 |
| Molecular Formula | C34H43N11O4S |
| Molecular Weight | 701.86 g/mol |
| Exact Mass | 701.32 |
| IUPAC Name | (E)-7-[2-(2-azidoethoxy)ethyl-methylamino]-1-[4-[[2-(1H-indazol-4-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazin-1-yl]hept-5-ene-1,4-dione |
| SMILES | CN(C/C=C/C(=O)CCC(=O)N1CCN(Cc2cc3nc(-c4cccc5[nH]ncc45)nc(N4CCOCC4)c3s2)CC1)CCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C34H43N11O4S/c1-42(15-19-48-18-9-36-41-35)10-3-4-25(46)7-8-31(47)44-13-11-43(12-14-44)24-26-22-30-32(50-26)34(45-16-20-49-21-17-45)39-33(38-30)27-5-2-6-29-28(27)23-37-40-29/h2-6,22-23H,7-21,24H2,1H3,(H,37,40)/b4-3+ |
| InChIKey | DSZYSLRVDWTUMF-ONEGZZNKSA-N |
| XLogP | 3.88 |
| TPSA | 168.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|