About 1-(2,4,4-trimethylpentan-2-yl)piperidine
1-(2,4,4-trimethylpentan-2-yl)piperidine (PubChem CID 58442300) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 1-(2,4,4-trimethylpentan-2-yl)piperidine.
Molecular Properties
| Compound Name | 1-(2,4,4-trimethylpentan-2-yl)piperidine |
| PubChem CID | 58442300 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 1-(2,4,4-trimethylpentan-2-yl)piperidine |
| SMILES | CC(C)(C)CC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C13H27N/c1-12(2,3)11-13(4,5)14-9-7-6-8-10-14/h6-11H2,1-5H3 |
| InChIKey | OLJPNQDDYLFODY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,4,4-trimethylpentan-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4,4-trimethylpentan-2-yl)piperidine?
The IUPAC name of 1-(2,4,4-trimethylpentan-2-yl)piperidine (CID 58442300) is 1-(2,4,4-trimethylpentan-2-yl)piperidine.
What is the SMILES notation for 1-(2,4,4-trimethylpentan-2-yl)piperidine?
The canonical SMILES for 1-(2,4,4-trimethylpentan-2-yl)piperidine is CC(C)(C)CC(C)(C)N1CCCCC1.
What is the InChIKey of 1-(2,4,4-trimethylpentan-2-yl)piperidine?
The InChIKey is OLJPNQDDYLFODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-12(2,3)11-13(4,5)14-9-7-6-8-10-14/h6-11H2,1-5H3.
What are the key properties of 1-(2,4,4-trimethylpentan-2-yl)piperidine?
1-(2,4,4-trimethylpentan-2-yl)piperidine has a molecular weight of 197.37 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4,4-trimethylpentan-2-yl)piperidine is sourced from PubChem (CID 58442300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).