About 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine
4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine (PubChem CID 58442382) has the molecular formula C15H20N2O2S
and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine |
| PubChem CID | 58442382 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine |
| SMILES | COCCCOc1cc(C)c(-c2csc(N)n2)c(C)c1 |
| InChI | InChI=1S/C15H20N2O2S/c1-10-7-12(19-6-4-5-18-3)8-11(2)14(10)13-9-20-15(16)17-13/h7-9H,4-6H2,1-3H3,(H2,16,17) |
| InChIKey | FKCYCGVPZMHGMN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine (CID 58442382) is 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine is COCCCOc1cc(C)c(-c2csc(N)n2)c(C)c1.
What is the InChIKey of 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine?
The InChIKey is FKCYCGVPZMHGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2S/c1-10-7-12(19-6-4-5-18-3)8-11(2)14(10)13-9-20-15(16)17-13/h7-9H,4-6H2,1-3H3,(H2,16,17).
What are the key properties of 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine?
4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine has a molecular weight of 292.40 g/mol, XLogP of 3.42, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 58442382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).