C18H26N2S — CID 58442454
4-[2,4,6-tri(propan-2-yl)phenyl]-1,3-thiazol-2-amine (PubChem CID 58442454) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is 4-[2,4,6-tri(propan-2-yl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2,4,6-tri(propan-2-yl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58442454 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-[2,4,6-tri(propan-2-yl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CC(C)c1cc(C(C)C)c(-c2csc(N)n2)c(C(C)C)c1 |
| InChI | InChI=1S/C18H26N2S/c1-10(2)13-7-14(11(3)4)17(15(8-13)12(5)6)16-9-21-18(19)20-16/h7-12H,1-6H3,(H2,19,20) |
| InChIKey | CPHWMBZBSNHOOJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |