C40H41N5O8 — CID 58443463
4-[[3-(carboxymethyl)-4-methyl-2-oxochromen-7-yl]amino]-3-[4-[(1S)-1-cyclohexyl-1-[[2-(3-phenylphenyl)acetyl]amino]ethyl]triazol-1-yl]-4-oxobutanoic acid (PubChem CID 58443463) has the molecular formula C40H41N5O8 and a molecular weight of 719.80 g/mol. Its IUPAC name is 4-[[3-(carboxymethyl)-4-methyl-2-oxochromen-7-yl]amino]-3-[4-[(1S)-1-cyclohexyl-1-[[2-(3-phenylphenyl)acetyl]amino]ethyl]triazol-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[[3-(carboxymethyl)-4-methyl-2-oxochromen-7-yl]amino]-3-[4-[(1S)-1-cyclohexyl-1-[[2-(3-phenylphenyl)acetyl]amino]ethyl]triazol-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58443463 |
| Molecular Formula | C40H41N5O8 |
| Molecular Weight | 719.80 g/mol |
| Exact Mass | 719.30 |
| IUPAC Name | 4-[[3-(carboxymethyl)-4-methyl-2-oxochromen-7-yl]amino]-3-[4-[(1S)-1-cyclohexyl-1-[[2-(3-phenylphenyl)acetyl]amino]ethyl]triazol-1-yl]-4-oxobutanoic acid |
| SMILES | Cc1c(CC(=O)O)c(=O)oc2cc(NC(=O)C(CC(=O)O)n3cc([C@@](C)(NC(=O)Cc4cccc(-c5ccccc5)c4)C4CCCCC4)nn3)ccc12 |
| InChI | InChI=1S/C40H41N5O8/c1-24-30-17-16-29(20-33(30)53-39(52)31(24)21-36(47)48)41-38(51)32(22-37(49)50)45-23-34(43-44-45)40(2,28-14-7-4-8-15-28)42-35(46)19-25-10-9-13-27(18-25)26-11-5-3-6-12-26/h3,5-6,9-13,16-18,20,23,28,32H,4,7-8,14-15,19,21-22H2,1-2H3,(H,41,51)(H,42,46)(H,47,48)(H,49,50)/t32?,40-/m0/s1 |
| InChIKey | LSYZUYZWLQSRAS-AARGLWAYSA-N |
| XLogP | 5.80 |
| TPSA | 193.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.80 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|