C20H27N3O3Si — CID 58443534
[4-[4-(4-ethenyl-1,3-oxazol-2-yl)-1,3-oxazol-2-yl]-1,3-oxazol-2-yl]-tri(propan-2-yl)silane (PubChem CID 58443534) has the molecular formula C20H27N3O3Si and a molecular weight of 385.54 g/mol. Its IUPAC name is [4-[4-(4-ethenyl-1,3-oxazol-2-yl)-1,3-oxazol-2-yl]-1,3-oxazol-2-yl]-tri(propan-2-yl)silane.
| Compound Name | [4-[4-(4-ethenyl-1,3-oxazol-2-yl)-1,3-oxazol-2-yl]-1,3-oxazol-2-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 58443534 |
| Molecular Formula | C20H27N3O3Si |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | [4-[4-(4-ethenyl-1,3-oxazol-2-yl)-1,3-oxazol-2-yl]-1,3-oxazol-2-yl]-tri(propan-2-yl)silane |
| SMILES | C=Cc1coc(-c2coc(-c3coc([Si](C(C)C)(C(C)C)C(C)C)n3)n2)n1 |
| InChI | InChI=1S/C20H27N3O3Si/c1-8-15-9-24-18(21-15)16-10-25-19(22-16)17-11-26-20(23-17)27(12(2)3,13(4)5)14(6)7/h8-14H,1H2,2-7H3 |
| InChIKey | PIMBDKXUJZJAHM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 78.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|