C25H17N7O7 — CID 58443560
2-[2-(2-ethenyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-N-[[2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 58443560) has the molecular formula C25H17N7O7 and a molecular weight of 527.45 g/mol. Its IUPAC name is 2-[2-(2-ethenyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-N-[[2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[2-(2-ethenyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-N-[[2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 58443560 |
| Molecular Formula | C25H17N7O7 |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 2-[2-(2-ethenyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-N-[[2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | C=CCc1nc(-c2nc(-c3nc(CNC(=O)c4coc(-c5coc(-c6coc(C=C)n6)n5)n4)co3)co2)co1 |
| InChI | InChI=1S/C25H17N7O7/c1-3-5-20-29-16(10-35-20)24-31-17(11-38-24)22-27-13(7-36-22)6-26-21(33)14-8-37-25(30-14)18-12-39-23(32-18)15-9-34-19(4-2)28-15/h3-4,7-12H,1-2,5-6H2,(H,26,33) |
| InChIKey | VNNPACDOLNFDIC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 185.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|