C26H18N6O6 — CID 58443568
4-ethenyl-2-[2-[2-[(E)-3-[2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]prop-2-enyl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazole (PubChem CID 58443568) has the molecular formula C26H18N6O6 and a molecular weight of 510.47 g/mol. Its IUPAC name is 4-ethenyl-2-[2-[2-[(E)-3-[2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]prop-2-enyl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazole.
| Compound Name | 4-ethenyl-2-[2-[2-[(E)-3-[2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]prop-2-enyl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 58443568 |
| Molecular Formula | C26H18N6O6 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 4-ethenyl-2-[2-[2-[(E)-3-[2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]prop-2-enyl]-1,3-oxazol-4-yl]-1,3-oxazol-4-yl]-1,3-oxazole |
| SMILES | C=CCc1nc(-c2nc(-c3nc(/C=C/Cc4nc(-c5nc(-c6nc(C=C)co6)co5)co4)co3)co2)co1 |
| InChI | InChI=1S/C26H18N6O6/c1-3-6-21-29-17(11-33-21)25-32-20(14-38-25)24-28-16(10-36-24)7-5-8-22-30-18(12-34-22)26-31-19(13-37-26)23-27-15(4-2)9-35-23/h3-5,7,9-14H,1-2,6,8H2/b7-5+ |
| InChIKey | DNHTVKNPKJVEAH-FNORWQNLSA-N |
| XLogP | 5.91 |
| TPSA | 156.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|