About (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione
(6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione (PubChem CID 58443709) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione.
Molecular Properties
| Compound Name | (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione |
| PubChem CID | 58443709 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione |
| SMILES | CC(C)/C=C1/C(=O)N(C)C(CC(C)C)C(=O)N1C |
| InChI | InChI=1S/C14H24N2O2/c1-9(2)7-11-13(17)16(6)12(8-10(3)4)14(18)15(11)5/h7,9-10,12H,8H2,1-6H3/b11-7- |
| InChIKey | PLNGTWWDIQCXJS-XFFZJAGNSA-N |
| XLogP | 1.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione?
The IUPAC name of (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione (CID 58443709) is (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione.
What is the SMILES notation for (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione?
The canonical SMILES for (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione is CC(C)/C=C1/C(=O)N(C)C(CC(C)C)C(=O)N1C.
What is the InChIKey of (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione?
The InChIKey is PLNGTWWDIQCXJS-XFFZJAGNSA-N. The full InChI is InChI=1S/C14H24N2O2/c1-9(2)7-11-13(17)16(6)12(8-10(3)4)14(18)15(11)5/h7,9-10,12H,8H2,1-6H3/b11-7-.
What are the key properties of (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione?
(6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione has a molecular weight of 252.36 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-1,4-dimethyl-3-(2-methylpropyl)-6-(2-methylpropylidene)piperazine-2,5-dione is sourced from PubChem (CID 58443709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).