C9H18 — CID 58443772
trans-(1S,4S)-1,2,3,4-tetramethylcyclopentane (PubChem CID 58443772) has the molecular formula C9H18 and a molecular weight of 126.24 g/mol. Its IUPAC name is trans-(1S,4S)-1,2,3,4-tetramethylcyclopentane.
| Compound Name | trans-(1S,4S)-1,2,3,4-tetramethylcyclopentane |
|---|---|
| PubChem CID | 58443772 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | trans-(1S,4S)-1,2,3,4-tetramethylcyclopentane |
| SMILES | CC1C(C)[C@@H](C)C[C@@H]1C |
| InChI | InChI=1S/C9H18/c1-6-5-7(2)9(4)8(6)3/h6-9H,5H2,1-4H3/t6-,7-,8?,9?/m0/s1 |
| InChIKey | INYXDKODFMWKER-MSIFESELSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |