C19H40O4Si2 — CID 58444201
(3R,4R,5S)-3,4-dimethyl-3-triethylsilyloxy-5-(triethylsilyloxymethyl)oxolan-2-one (PubChem CID 58444201) has the molecular formula C19H40O4Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is (3R,4R,5S)-3,4-dimethyl-3-triethylsilyloxy-5-(triethylsilyloxymethyl)oxolan-2-one.
| Compound Name | (3R,4R,5S)-3,4-dimethyl-3-triethylsilyloxy-5-(triethylsilyloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 58444201 |
| Molecular Formula | C19H40O4Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (3R,4R,5S)-3,4-dimethyl-3-triethylsilyloxy-5-(triethylsilyloxymethyl)oxolan-2-one |
| SMILES | CC[Si](CC)(CC)OC[C@H]1OC(=O)[C@](C)(O[Si](CC)(CC)CC)[C@@H]1C |
| InChI | InChI=1S/C19H40O4Si2/c1-9-24(10-2,11-3)21-15-17-16(7)19(8,18(20)22-17)23-25(12-4,13-5)14-6/h16-17H,9-15H2,1-8H3/t16-,17-,19-/m1/s1 |
| InChIKey | NRYDKPKAHKRERS-ZHALLVOQSA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|