C48H45B3O6 — CID 58444262
6,15,24-tris(4-tert-butylphenyl)-5,7,14,16,23,25-hexaoxa-6,15,24-triboraheptacyclo[18.7.0.02,10.04,8.011,19.013,17.022,26]heptacosa-1(27),2,4(8),9,11,13(17),18,20,22(26)-nonaene (PubChem CID 58444262) has the molecular formula C48H45B3O6 and a molecular weight of 750.32 g/mol. Its IUPAC name is 6,15,24-tris(4-tert-butylphenyl)-5,7,14,16,23,25-hexaoxa-6,15,24-triboraheptacyclo[18.7.0.02,10.04,8.011,19.013,17.022,26]heptacosa-1(27),2,4(8),9,11,13(17),18,20,22(26)-nonaene.
| Compound Name | 6,15,24-tris(4-tert-butylphenyl)-5,7,14,16,23,25-hexaoxa-6,15,24-triboraheptacyclo[18.7.0.02,10.04,8.011,19.013,17.022,26]heptacosa-1(27),2,4(8),9,11,13(17),18,20,22(26)-nonaene |
|---|---|
| PubChem CID | 58444262 |
| Molecular Formula | C48H45B3O6 |
| Molecular Weight | 750.32 g/mol |
| Exact Mass | 750.35 |
| IUPAC Name | 6,15,24-tris(4-tert-butylphenyl)-5,7,14,16,23,25-hexaoxa-6,15,24-triboraheptacyclo[18.7.0.02,10.04,8.011,19.013,17.022,26]heptacosa-1(27),2,4(8),9,11,13(17),18,20,22(26)-nonaene |
| SMILES | CC(C)(C)c1ccc(B2Oc3cc4c5cc6c(cc5c5cc7c(cc5c4cc3O2)OB(c2ccc(C(C)(C)C)cc2)O7)OB(c2ccc(C(C)(C)C)cc2)O6)cc1 |
| InChI | InChI=1S/C48H45B3O6/c1-46(2,3)28-10-16-31(17-11-28)49-52-40-22-34-35(23-41(40)53-49)37-25-43-45(57-51(55-43)33-20-14-30(15-21-33)48(7,8)9)27-39(37)38-26-44-42(24-36(34)38)54-50(56-44)32-18-12-29(13-19-32)47(4,5)6/h10-27H,1-9H3 |
| InChIKey | YGPCMEUSJQDNKV-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.32 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|