About [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate
[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate (PubChem CID 58444277) has the molecular formula C19H24O9
and a molecular weight of 396.39 g/mol. Its IUPAC name is [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate.
Molecular Properties
| Compound Name | [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate |
| PubChem CID | 58444277 |
| Molecular Formula | C19H24O9 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)CCC(C)=O |
| InChI | InChI=1S/C19H24O9/c1-5-15(21)25-10-19(11-26-16(22)6-2,12-27-17(23)7-3)13-28-18(24)9-8-14(4)20/h5-7H,1-3,8-13H2,4H3 |
| InChIKey | GKKZNMLKYDTVCH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate?
The IUPAC name of [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate (CID 58444277) is [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate.
What is the SMILES notation for [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate?
The canonical SMILES for [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate is C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)CCC(C)=O.
What is the InChIKey of [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate?
The InChIKey is GKKZNMLKYDTVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O9/c1-5-15(21)25-10-19(11-26-16(22)6-2,12-27-17(23)7-3)13-28-18(24)9-8-14(4)20/h5-7H,1-3,8-13H2,4H3.
What are the key properties of [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate?
[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate has a molecular weight of 396.39 g/mol, XLogP of 1.07, 14 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propyl] 4-oxopentanoate is sourced from PubChem (CID 58444277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).