C22H15F5N5Pt- — CID 58444365
2,6-difluoro-3-[6-[2-[6-[4-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]propan-2-yl]-2-pyridinyl]-4H-pyridin-4-ide;platinum (PubChem CID 58444365) has the molecular formula C22H15F5N5Pt- and a molecular weight of 639.47 g/mol. Its IUPAC name is 2,6-difluoro-3-[6-[2-[6-[4-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]propan-2-yl]-2-pyridinyl]-4H-pyridin-4-ide;platinum.
| Compound Name | 2,6-difluoro-3-[6-[2-[6-[4-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]propan-2-yl]-2-pyridinyl]-4H-pyridin-4-ide;platinum |
|---|---|
| PubChem CID | 58444365 |
| Molecular Formula | C22H15F5N5Pt- |
| Molecular Weight | 639.47 g/mol |
| Exact Mass | 639.09 |
| IUPAC Name | 2,6-difluoro-3-[6-[2-[6-[4-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]propan-2-yl]-2-pyridinyl]-4H-pyridin-4-ide;platinum |
| SMILES | CC(C)(c1cccc(-c2[c-]cc(F)nc2F)n1)c1cccc(-n2cc(C(F)(F)F)cn2)n1.[Pt] |
| InChI | InChI=1S/C22H15F5N5.Pt/c1-21(2,16-6-3-5-15(29-16)14-9-10-18(23)31-20(14)24)17-7-4-8-19(30-17)32-12-13(11-28-32)22(25,26)27;/h3-8,10-12H,1-2H3;/q-1; |
| InChIKey | GVRUSOFIEVMKNE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|