About CID 58444857
CID 58444857 (PubChem CID 58444857) has the molecular formula C37H34F3N5Pt
and a molecular weight of 800.79 g/mol.
Molecular Properties
| Compound Name | CID 58444857 |
| PubChem CID | 58444857 |
| Molecular Formula | C37H34F3N5Pt |
| Molecular Weight | 800.79 g/mol |
| Exact Mass | 800.24 |
| IUPAC Name | — |
| SMILES | Cc1cc2nc(c1)C(C)(C)c1cc(N(C)C)cc(n1)-n1[c-]c3c(cccc3c1C(F)(F)F)C(C)(C)c1cccc3c(C)n-2[c-]c13.[Pt+2] |
| InChI | InChI=1S/C37H34F3N5.Pt/c1-21-15-30-36(5,6)31-17-23(43(7)8)18-33(42-31)45-20-27-25(34(45)37(38,39)40)12-10-14-29(27)35(3,4)28-13-9-11-24-22(2)44(19-26(24)28)32(16-21)41-30;/h9-18H,1-8H3;/q-2;+2 |
| InChIKey | AKWBNMHWFIKVLQ-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 800.79 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58444857 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58444857?
The IUPAC name of CID 58444857 (CID 58444857) is not available.
What is the SMILES notation for CID 58444857?
The canonical SMILES for CID 58444857 is Cc1cc2nc(c1)C(C)(C)c1cc(N(C)C)cc(n1)-n1[c-]c3c(cccc3c1C(F)(F)F)C(C)(C)c1cccc3c(C)n-2[c-]c13.[Pt+2].
What is the InChIKey of CID 58444857?
The InChIKey is AKWBNMHWFIKVLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H34F3N5.Pt/c1-21-15-30-36(5,6)31-17-23(43(7)8)18-33(42-31)45-20-27-25(34(45)37(38,39)40)12-10-14-29(27)35(3,4)28-13-9-11-24-22(2)44(19-26(24)28)32(16-21)41-30;/h9-18H,1-8H3;/q-2;+2.
What are the key properties of CID 58444857?
CID 58444857 has a molecular weight of 800.79 g/mol, XLogP of 8.63, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58444857 is sourced from PubChem (CID 58444857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).