C24H41NO9 — CID 58444913
N-[2-hydroxy-3-[3-(2-hydroxy-5-oxohept-6-enoxy)-2-(2-hydroxy-5-oxooctoxy)propoxy]propyl]prop-2-enamide (PubChem CID 58444913) has the molecular formula C24H41NO9 and a molecular weight of 487.59 g/mol. Its IUPAC name is N-[2-hydroxy-3-[3-(2-hydroxy-5-oxohept-6-enoxy)-2-(2-hydroxy-5-oxooctoxy)propoxy]propyl]prop-2-enamide.
| Compound Name | N-[2-hydroxy-3-[3-(2-hydroxy-5-oxohept-6-enoxy)-2-(2-hydroxy-5-oxooctoxy)propoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 58444913 |
| Molecular Formula | C24H41NO9 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | N-[2-hydroxy-3-[3-(2-hydroxy-5-oxohept-6-enoxy)-2-(2-hydroxy-5-oxooctoxy)propoxy]propyl]prop-2-enamide |
| SMILES | C=CC(=O)CCC(O)COCC(COCC(O)CNC(=O)C=C)OCC(O)CCC(=O)CCC |
| InChI | InChI=1S/C24H41NO9/c1-4-7-19(27)9-11-21(29)15-34-23(16-32-13-20(28)10-8-18(26)5-2)17-33-14-22(30)12-25-24(31)6-3/h5-6,20-23,28-30H,2-4,7-17H2,1H3,(H,25,31) |
| InChIKey | WHEQEWDRNYKLJW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|