C29H27F5O6S2 — CID 58445298
2-[(6aR,7S,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 58445298) has the molecular formula C29H27F5O6S2 and a molecular weight of 630.65 g/mol. Its IUPAC name is 2-[(6aR,7S,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(6aR,7S,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58445298 |
| Molecular Formula | C29H27F5O6S2 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | 2-[(6aR,7S,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H]2CCC[C@@]3(S(=O)(=O)c4ccc(C(F)(F)F)cc4)c4c(F)ccc(F)c4OC[C@@H]23)cc1 |
| InChI | InChI=1S/C29H27F5O6S2/c1-18-4-8-22(9-5-18)42(37,38)40-16-14-19-3-2-15-28(23(19)17-39-27-25(31)13-12-24(30)26(27)28)41(35,36)21-10-6-20(7-11-21)29(32,33)34/h4-13,19,23H,2-3,14-17H2,1H3/t19-,23-,28-/m0/s1 |
| InChIKey | YOKFTSZIVPCRCR-AMAALNMCSA-N |
| XLogP | 6.57 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|